About 3-[[2-aminoethyl(ethyl)sulfamoyl]amino]-1,1-difluoropropane
3-[[2-aminoethyl(ethyl)sulfamoyl]amino]-1,1-difluoropropane (PubChem CID 155056426) has the molecular formula C7H17F2N3O2S
and a molecular weight of 245.29 g/mol. Its IUPAC name is 3-[[2-aminoethyl(ethyl)sulfamoyl]amino]-1,1-difluoropropane.
Molecular Properties
| Compound Name | 3-[[2-aminoethyl(ethyl)sulfamoyl]amino]-1,1-difluoropropane |
| PubChem CID | 155056426 |
| Molecular Formula | C7H17F2N3O2S |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 3-[[2-aminoethyl(ethyl)sulfamoyl]amino]-1,1-difluoropropane |
| SMILES | CCN(CCN)S(=O)(=O)NCCC(F)F |
| InChI | InChI=1S/C7H17F2N3O2S/c1-2-12(6-4-10)15(13,14)11-5-3-7(8)9/h7,11H,2-6,10H2,1H3 |
| InChIKey | LTVMIDBJRNCBGQ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[2-aminoethyl(ethyl)sulfamoyl]amino]-1,1-difluoropropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-aminoethyl(ethyl)sulfamoyl]amino]-1,1-difluoropropane?
The IUPAC name of 3-[[2-aminoethyl(ethyl)sulfamoyl]amino]-1,1-difluoropropane (CID 155056426) is 3-[[2-aminoethyl(ethyl)sulfamoyl]amino]-1,1-difluoropropane.
What is the SMILES notation for 3-[[2-aminoethyl(ethyl)sulfamoyl]amino]-1,1-difluoropropane?
The canonical SMILES for 3-[[2-aminoethyl(ethyl)sulfamoyl]amino]-1,1-difluoropropane is CCN(CCN)S(=O)(=O)NCCC(F)F.
What is the InChIKey of 3-[[2-aminoethyl(ethyl)sulfamoyl]amino]-1,1-difluoropropane?
The InChIKey is LTVMIDBJRNCBGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17F2N3O2S/c1-2-12(6-4-10)15(13,14)11-5-3-7(8)9/h7,11H,2-6,10H2,1H3.
What are the key properties of 3-[[2-aminoethyl(ethyl)sulfamoyl]amino]-1,1-difluoropropane?
3-[[2-aminoethyl(ethyl)sulfamoyl]amino]-1,1-difluoropropane has a molecular weight of 245.29 g/mol, XLogP of -0.24, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-aminoethyl(ethyl)sulfamoyl]amino]-1,1-difluoropropane is sourced from PubChem (CID 155056426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).