4,4-dimethyl-5-methyliminopentanoic acid

C8H15NO2 — CID 155056763

IUPAC4,4-dimethyl-5-methyliminopentanoic acid
SMILESC/N=C/C(C)(C)CCC(=O)O
InChIInChI=1S/C8H15NO2/c1-8(2,6-9-3)5-4-7(10)11/h6H,4-5H2,1-3H3,(H,10,11)/b9-6+
InChIKeyNCNZPVWXRPEWLO-RMKNXTFCSA-N
MW157.21 g/mol
LogP1.58
Rot. Bonds4

About 4,4-dimethyl-5-methyliminopentanoic acid

4,4-dimethyl-5-methyliminopentanoic acid (PubChem CID 155056763) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is 4,4-dimethyl-5-methyliminopentanoic acid.

Molecular Properties

Compound Name4,4-dimethyl-5-methyliminopentanoic acid
PubChem CID155056763
Molecular FormulaC8H15NO2
Molecular Weight157.21 g/mol
Exact Mass157.11
IUPAC Name4,4-dimethyl-5-methyliminopentanoic acid
SMILESC/N=C/C(C)(C)CCC(=O)O
InChIInChI=1S/C8H15NO2/c1-8(2,6-9-3)5-4-7(10)11/h6H,4-5H2,1-3H3,(H,10,11)/b9-6+
InChIKeyNCNZPVWXRPEWLO-RMKNXTFCSA-N
XLogP1.58
TPSA49.66 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500157.21
LogP ≤ 51.58
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze 4,4-dimethyl-5-methyliminopentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,4-dimethyl-5-methyliminopentanoic acid?
The IUPAC name of 4,4-dimethyl-5-methyliminopentanoic acid (CID 155056763) is 4,4-dimethyl-5-methyliminopentanoic acid.
What is the SMILES notation for 4,4-dimethyl-5-methyliminopentanoic acid?
The canonical SMILES for 4,4-dimethyl-5-methyliminopentanoic acid is C/N=C/C(C)(C)CCC(=O)O.
What is the InChIKey of 4,4-dimethyl-5-methyliminopentanoic acid?
The InChIKey is NCNZPVWXRPEWLO-RMKNXTFCSA-N. The full InChI is InChI=1S/C8H15NO2/c1-8(2,6-9-3)5-4-7(10)11/h6H,4-5H2,1-3H3,(H,10,11)/b9-6+.
What are the key properties of 4,4-dimethyl-5-methyliminopentanoic acid?
4,4-dimethyl-5-methyliminopentanoic acid has a molecular weight of 157.21 g/mol, XLogP of 1.58, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-5-methyliminopentanoic acid is sourced from PubChem (CID 155056763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).