C53H69N3O4 — CID 155056795
(E)-N-butyl-N'-[4-methoxy-3-[4-[4-methoxy-N-[(4-methylphenyl)methyl]anilino]butyl]phenyl]-N,N'-bis[(4-methoxyphenyl)methyl]hept-2-ene-1,7-diamine (PubChem CID 155056795) has the molecular formula C53H69N3O4 and a molecular weight of 812.15 g/mol. Its IUPAC name is (E)-N-butyl-N'-[4-methoxy-3-[4-[4-methoxy-N-[(4-methylphenyl)methyl]anilino]butyl]phenyl]-N,N'-bis[(4-methoxyphenyl)methyl]hept-2-ene-1,7-diamine.
| Compound Name | (E)-N-butyl-N'-[4-methoxy-3-[4-[4-methoxy-N-[(4-methylphenyl)methyl]anilino]butyl]phenyl]-N,N'-bis[(4-methoxyphenyl)methyl]hept-2-ene-1,7-diamine |
|---|---|
| PubChem CID | 155056795 |
| Molecular Formula | C53H69N3O4 |
| Molecular Weight | 812.15 g/mol |
| Exact Mass | 811.53 |
| IUPAC Name | (E)-N-butyl-N'-[4-methoxy-3-[4-[4-methoxy-N-[(4-methylphenyl)methyl]anilino]butyl]phenyl]-N,N'-bis[(4-methoxyphenyl)methyl]hept-2-ene-1,7-diamine |
| SMILES | CCCCN(C/C=C/CCCCN(Cc1ccc(OC)cc1)c1ccc(OC)c(CCCCN(Cc2ccc(C)cc2)c2ccc(OC)cc2)c1)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C53H69N3O4/c1-7-8-35-54(40-44-21-28-50(57-3)29-22-44)36-13-10-9-11-14-37-56(42-46-23-30-51(58-4)31-24-46)49-27-34-53(60-6)47(39-49)16-12-15-38-55(41-45-19-17-43(2)18-20-45)48-25-32-52(59-5)33-26-48/h10,13,17-34,39H,7-9,11-12,14-16,35-38,40-42H2,1-6H3/b13-10+ |
| InChIKey | QOIVHAGJKDVEFX-JLHYYAGUSA-N |
| XLogP | 12.09 |
| TPSA | 46.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.15 |
| LogP ≤ 5 | 12.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|