C12H16O3 — CID 15505682
(4S,4aR,9aR)-4a,6,7,8,9,9a-hexahydro-4H-dibenzofuran-4,5a-diol (PubChem CID 15505682) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is (4S,4aR,9aR)-4a,6,7,8,9,9a-hexahydro-4H-dibenzofuran-4,5a-diol.
| Compound Name | (4S,4aR,9aR)-4a,6,7,8,9,9a-hexahydro-4H-dibenzofuran-4,5a-diol |
|---|---|
| PubChem CID | 15505682 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (4S,4aR,9aR)-4a,6,7,8,9,9a-hexahydro-4H-dibenzofuran-4,5a-diol |
| SMILES | O[C@H]1C=CC=C2[C@H]1OC1(O)CCCC[C@H]21 |
| InChI | InChI=1S/C12H16O3/c13-10-6-3-4-8-9-5-1-2-7-12(9,14)15-11(8)10/h3-4,6,9-11,13-14H,1-2,5,7H2/t9-,10+,11-,12?/m1/s1 |
| InChIKey | PRZGTCDCFNQJST-FBTJUVTCSA-N |
| XLogP | 1.12 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |