About 4-[1,3-dioxo-4-[2-oxo-2-(10-oxodecylamino)ethoxy]isoindol-2-yl]-N-formylpentanamide
4-[1,3-dioxo-4-[2-oxo-2-(10-oxodecylamino)ethoxy]isoindol-2-yl]-N-formylpentanamide (PubChem CID 155057033) has the molecular formula C26H35N3O7
and a molecular weight of 501.58 g/mol. Its IUPAC name is 4-[1,3-dioxo-4-[2-oxo-2-(10-oxodecylamino)ethoxy]isoindol-2-yl]-N-formylpentanamide.
Molecular Properties
| Compound Name | 4-[1,3-dioxo-4-[2-oxo-2-(10-oxodecylamino)ethoxy]isoindol-2-yl]-N-formylpentanamide |
| PubChem CID | 155057033 |
| Molecular Formula | C26H35N3O7 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | 4-[1,3-dioxo-4-[2-oxo-2-(10-oxodecylamino)ethoxy]isoindol-2-yl]-N-formylpentanamide |
| SMILES | CC(CCC(=O)NC=O)N1C(=O)c2cccc(OCC(=O)NCCCCCCCCCC=O)c2C1=O |
| InChI | InChI=1S/C26H35N3O7/c1-19(13-14-22(32)28-18-31)29-25(34)20-11-10-12-21(24(20)26(29)35)36-17-23(33)27-15-8-6-4-2-3-5-7-9-16-30/h10-12,16,18-19H,2-9,13-15,17H2,1H3,(H,27,33)(H,28,31,32) |
| InChIKey | PFXFHKOZGJWAJO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-[1,3-dioxo-4-[2-oxo-2-(10-oxodecylamino)ethoxy]isoindol-2-yl]-N-formylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1,3-dioxo-4-[2-oxo-2-(10-oxodecylamino)ethoxy]isoindol-2-yl]-N-formylpentanamide?
The IUPAC name of 4-[1,3-dioxo-4-[2-oxo-2-(10-oxodecylamino)ethoxy]isoindol-2-yl]-N-formylpentanamide (CID 155057033) is 4-[1,3-dioxo-4-[2-oxo-2-(10-oxodecylamino)ethoxy]isoindol-2-yl]-N-formylpentanamide.
What is the SMILES notation for 4-[1,3-dioxo-4-[2-oxo-2-(10-oxodecylamino)ethoxy]isoindol-2-yl]-N-formylpentanamide?
The canonical SMILES for 4-[1,3-dioxo-4-[2-oxo-2-(10-oxodecylamino)ethoxy]isoindol-2-yl]-N-formylpentanamide is CC(CCC(=O)NC=O)N1C(=O)c2cccc(OCC(=O)NCCCCCCCCCC=O)c2C1=O.
What is the InChIKey of 4-[1,3-dioxo-4-[2-oxo-2-(10-oxodecylamino)ethoxy]isoindol-2-yl]-N-formylpentanamide?
The InChIKey is PFXFHKOZGJWAJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H35N3O7/c1-19(13-14-22(32)28-18-31)29-25(34)20-11-10-12-21(24(20)26(29)35)36-17-23(33)27-15-8-6-4-2-3-5-7-9-16-30/h10-12,16,18-19H,2-9,13-15,17H2,1H3,(H,27,33)(H,28,31,32).
What are the key properties of 4-[1,3-dioxo-4-[2-oxo-2-(10-oxodecylamino)ethoxy]isoindol-2-yl]-N-formylpentanamide?
4-[1,3-dioxo-4-[2-oxo-2-(10-oxodecylamino)ethoxy]isoindol-2-yl]-N-formylpentanamide has a molecular weight of 501.58 g/mol, XLogP of 2.54, 18 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1,3-dioxo-4-[2-oxo-2-(10-oxodecylamino)ethoxy]isoindol-2-yl]-N-formylpentanamide is sourced from PubChem (CID 155057033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).