About (5S)-1-amino-5-fluoro-2,3,4-trimethylhexan-2-ol
(5S)-1-amino-5-fluoro-2,3,4-trimethylhexan-2-ol (PubChem CID 155057078) has the molecular formula C9H20FNO
and a molecular weight of 177.26 g/mol. Its IUPAC name is (5S)-1-amino-5-fluoro-2,3,4-trimethylhexan-2-ol.
Molecular Properties
| Compound Name | (5S)-1-amino-5-fluoro-2,3,4-trimethylhexan-2-ol |
| PubChem CID | 155057078 |
| Molecular Formula | C9H20FNO |
| Molecular Weight | 177.26 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | (5S)-1-amino-5-fluoro-2,3,4-trimethylhexan-2-ol |
| SMILES | CC(C(C)C(C)(O)CN)[C@H](C)F |
| InChI | InChI=1S/C9H20FNO/c1-6(8(3)10)7(2)9(4,12)5-11/h6-8,12H,5,11H2,1-4H3/t6?,7?,8-,9?/m0/s1 |
| InChIKey | XCOQEVYBTHIBHE-HZMRZXPBSA-N |
| XLogP | 1.33 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5S)-1-amino-5-fluoro-2,3,4-trimethylhexan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-1-amino-5-fluoro-2,3,4-trimethylhexan-2-ol?
The IUPAC name of (5S)-1-amino-5-fluoro-2,3,4-trimethylhexan-2-ol (CID 155057078) is (5S)-1-amino-5-fluoro-2,3,4-trimethylhexan-2-ol.
What is the SMILES notation for (5S)-1-amino-5-fluoro-2,3,4-trimethylhexan-2-ol?
The canonical SMILES for (5S)-1-amino-5-fluoro-2,3,4-trimethylhexan-2-ol is CC(C(C)C(C)(O)CN)[C@H](C)F.
What is the InChIKey of (5S)-1-amino-5-fluoro-2,3,4-trimethylhexan-2-ol?
The InChIKey is XCOQEVYBTHIBHE-HZMRZXPBSA-N. The full InChI is InChI=1S/C9H20FNO/c1-6(8(3)10)7(2)9(4,12)5-11/h6-8,12H,5,11H2,1-4H3/t6?,7?,8-,9?/m0/s1.
What are the key properties of (5S)-1-amino-5-fluoro-2,3,4-trimethylhexan-2-ol?
(5S)-1-amino-5-fluoro-2,3,4-trimethylhexan-2-ol has a molecular weight of 177.26 g/mol, XLogP of 1.33, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-1-amino-5-fluoro-2,3,4-trimethylhexan-2-ol is sourced from PubChem (CID 155057078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).