C11H17FN2O — CID 155057396
cis-(2S,5R)-5-fluoro-6-imidazol-1-yl-2-methylcycloheptan-1-ol (PubChem CID 155057396) has the molecular formula C11H17FN2O and a molecular weight of 212.27 g/mol. Its IUPAC name is cis-(2S,5R)-5-fluoro-6-imidazol-1-yl-2-methylcycloheptan-1-ol.
| Compound Name | cis-(2S,5R)-5-fluoro-6-imidazol-1-yl-2-methylcycloheptan-1-ol |
|---|---|
| PubChem CID | 155057396 |
| Molecular Formula | C11H17FN2O |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | cis-(2S,5R)-5-fluoro-6-imidazol-1-yl-2-methylcycloheptan-1-ol |
| SMILES | C[C@H]1CC[C@@H](F)C(n2ccnc2)CC1O |
| InChI | InChI=1S/C11H17FN2O/c1-8-2-3-9(12)10(6-11(8)15)14-5-4-13-7-14/h4-5,7-11,15H,2-3,6H2,1H3/t8-,9+,10?,11?/m0/s1 |
| InChIKey | HELIVUCBUKJJPB-IZUQBHJASA-N |
| XLogP | 1.94 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |