About 3,5-diiodophenol
3,5-diiodophenol (PubChem CID 15505783) has the molecular formula C6H4I2O
and a molecular weight of 345.91 g/mol. Its IUPAC name is 3,5-diiodophenol.
Molecular Properties
| Compound Name | 3,5-diiodophenol |
| PubChem CID | 15505783 |
| Molecular Formula | C6H4I2O |
| Molecular Weight | 345.91 g/mol |
| Exact Mass | 345.84 |
| IUPAC Name | 3,5-diiodophenol |
| SMILES | Oc1cc(I)cc(I)c1 |
| InChI | InChI=1S/C6H4I2O/c7-4-1-5(8)3-6(9)2-4/h1-3,9H |
| InChIKey | KYRNAIDRKAWDLJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.91 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3,5-diiodophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diiodophenol?
The IUPAC name of 3,5-diiodophenol (CID 15505783) is 3,5-diiodophenol.
What is the SMILES notation for 3,5-diiodophenol?
The canonical SMILES for 3,5-diiodophenol is Oc1cc(I)cc(I)c1.
What is the InChIKey of 3,5-diiodophenol?
The InChIKey is KYRNAIDRKAWDLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4I2O/c7-4-1-5(8)3-6(9)2-4/h1-3,9H.
What are the key properties of 3,5-diiodophenol?
3,5-diiodophenol has a molecular weight of 345.91 g/mol, XLogP of 2.60, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diiodophenol is sourced from PubChem (CID 15505783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).