C40H24N2O4 — CID 155058059
9-[8-(3,6-dihydroxyphenanthren-9-yl)-1,10-phenanthrolin-3-yl]phenanthrene-3,6-diol (PubChem CID 155058059) has the molecular formula C40H24N2O4 and a molecular weight of 596.64 g/mol. Its IUPAC name is 9-[8-(3,6-dihydroxyphenanthren-9-yl)-1,10-phenanthrolin-3-yl]phenanthrene-3,6-diol.
| Compound Name | 9-[8-(3,6-dihydroxyphenanthren-9-yl)-1,10-phenanthrolin-3-yl]phenanthrene-3,6-diol |
|---|---|
| PubChem CID | 155058059 |
| Molecular Formula | C40H24N2O4 |
| Molecular Weight | 596.64 g/mol |
| Exact Mass | 596.17 |
| IUPAC Name | 9-[8-(3,6-dihydroxyphenanthren-9-yl)-1,10-phenanthrolin-3-yl]phenanthrene-3,6-diol |
| SMILES | Oc1ccc2cc(-c3cnc4c(ccc5cc(-c6cc7ccc(O)cc7c7cc(O)ccc67)cnc54)c3)c3ccc(O)cc3c2c1 |
| InChI | InChI=1S/C40H24N2O4/c43-27-5-3-21-13-33(31-9-7-29(45)17-37(31)35(21)15-27)25-11-23-1-2-24-12-26(20-42-40(24)39(23)41-19-25)34-14-22-4-6-28(44)16-36(22)38-18-30(46)8-10-32(34)38/h1-20,43-46H |
| InChIKey | VBUCJVRXPIQYKJ-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.64 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|