C24H35NO7 — CID 15505815
dimethyl (2'R,5'S)-5,5-dimethyl-2'-morpholin-4-ylspiro[1,3-dioxane-2,8'-tricyclo[5.3.1.02,5]undec-3-ene]-3',4'-dicarboxylate (PubChem CID 15505815) has the molecular formula C24H35NO7 and a molecular weight of 449.54 g/mol. Its IUPAC name is dimethyl (2'R,5'S)-5,5-dimethyl-2'-morpholin-4-ylspiro[1,3-dioxane-2,8'-tricyclo[5.3.1.02,5]undec-3-ene]-3',4'-dicarboxylate.
| Compound Name | dimethyl (2'R,5'S)-5,5-dimethyl-2'-morpholin-4-ylspiro[1,3-dioxane-2,8'-tricyclo[5.3.1.02,5]undec-3-ene]-3',4'-dicarboxylate |
|---|---|
| PubChem CID | 15505815 |
| Molecular Formula | C24H35NO7 |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | dimethyl (2'R,5'S)-5,5-dimethyl-2'-morpholin-4-ylspiro[1,3-dioxane-2,8'-tricyclo[5.3.1.02,5]undec-3-ene]-3',4'-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@]2(N3CCOCC3)C3CCC4(OCC(C)(C)CO4)C(C3)C[C@@H]12 |
| InChI | InChI=1S/C24H35NO7/c1-22(2)13-31-23(32-14-22)6-5-15-11-16(23)12-17-18(20(26)28-3)19(21(27)29-4)24(15,17)25-7-9-30-10-8-25/h15-17H,5-14H2,1-4H3/t15?,16?,17-,24+/m0/s1 |
| InChIKey | LWHLKDOEZIFYPN-GVEMPHDCSA-N |
| XLogP | 1.92 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |