C22H24F3N3O2 — CID 155058358
(Z)-3-amino-4,4,4-trifluoro-1-[2-methyl-3-[4-(piperidine-1-carbonyl)phenyl]-2H-pyridin-1-yl]but-2-en-1-one (PubChem CID 155058358) has the molecular formula C22H24F3N3O2 and a molecular weight of 419.45 g/mol. Its IUPAC name is (Z)-3-amino-4,4,4-trifluoro-1-[2-methyl-3-[4-(piperidine-1-carbonyl)phenyl]-2H-pyridin-1-yl]but-2-en-1-one.
| Compound Name | (Z)-3-amino-4,4,4-trifluoro-1-[2-methyl-3-[4-(piperidine-1-carbonyl)phenyl]-2H-pyridin-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 155058358 |
| Molecular Formula | C22H24F3N3O2 |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | (Z)-3-amino-4,4,4-trifluoro-1-[2-methyl-3-[4-(piperidine-1-carbonyl)phenyl]-2H-pyridin-1-yl]but-2-en-1-one |
| SMILES | CC1C(c2ccc(C(=O)N3CCCCC3)cc2)=CC=CN1C(=O)/C=C(\N)C(F)(F)F |
| InChI | InChI=1S/C22H24F3N3O2/c1-15-18(6-5-13-28(15)20(29)14-19(26)22(23,24)25)16-7-9-17(10-8-16)21(30)27-11-3-2-4-12-27/h5-10,13-15H,2-4,11-12,26H2,1H3/b19-14- |
| InChIKey | VAYMSVANIAVJDD-RGEXLXHISA-N |
| XLogP | 3.85 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|