C18H20N6O2 — CID 155058609
5-(3,5-dimethylanilino)-7-(methylamino)-N-(2-oxoethyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 155058609) has the molecular formula C18H20N6O2 and a molecular weight of 352.40 g/mol. Its IUPAC name is 5-(3,5-dimethylanilino)-7-(methylamino)-N-(2-oxoethyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 5-(3,5-dimethylanilino)-7-(methylamino)-N-(2-oxoethyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 155058609 |
| Molecular Formula | C18H20N6O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 5-(3,5-dimethylanilino)-7-(methylamino)-N-(2-oxoethyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | CNc1cc(Nc2cc(C)cc(C)c2)nc2c(C(=O)NCC=O)cnn12 |
| InChI | InChI=1S/C18H20N6O2/c1-11-6-12(2)8-13(7-11)22-15-9-16(19-3)24-17(23-15)14(10-21-24)18(26)20-4-5-25/h5-10,19H,4H2,1-3H3,(H,20,26)(H,22,23) |
| InChIKey | OQOZJUHIYNBRSS-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 100.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|