About 2,4-dichloro-7,8-dihydroquinazoline
2,4-dichloro-7,8-dihydroquinazoline (PubChem CID 155058640) has the molecular formula C8H6Cl2N2
and a molecular weight of 201.06 g/mol. Its IUPAC name is 2,4-dichloro-7,8-dihydroquinazoline.
Molecular Properties
| Compound Name | 2,4-dichloro-7,8-dihydroquinazoline |
| PubChem CID | 155058640 |
| Molecular Formula | C8H6Cl2N2 |
| Molecular Weight | 201.06 g/mol |
| Exact Mass | 199.99 |
| IUPAC Name | 2,4-dichloro-7,8-dihydroquinazoline |
| SMILES | Clc1nc(Cl)c2c(n1)CCC=C2 |
| InChI | InChI=1S/C8H6Cl2N2/c9-7-5-3-1-2-4-6(5)11-8(10)12-7/h1,3H,2,4H2 |
| InChIKey | XIOZQTKHLVGDAK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.06 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-dichloro-7,8-dihydroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-7,8-dihydroquinazoline?
The IUPAC name of 2,4-dichloro-7,8-dihydroquinazoline (CID 155058640) is 2,4-dichloro-7,8-dihydroquinazoline.
What is the SMILES notation for 2,4-dichloro-7,8-dihydroquinazoline?
The canonical SMILES for 2,4-dichloro-7,8-dihydroquinazoline is Clc1nc(Cl)c2c(n1)CCC=C2.
What is the InChIKey of 2,4-dichloro-7,8-dihydroquinazoline?
The InChIKey is XIOZQTKHLVGDAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Cl2N2/c9-7-5-3-1-2-4-6(5)11-8(10)12-7/h1,3H,2,4H2.
What are the key properties of 2,4-dichloro-7,8-dihydroquinazoline?
2,4-dichloro-7,8-dihydroquinazoline has a molecular weight of 201.06 g/mol, XLogP of 2.74, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-7,8-dihydroquinazoline is sourced from PubChem (CID 155058640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).