About 5-[(Z)-but-1-enyl]-2,4-dichloro-6-ethylpyrimidine
5-[(Z)-but-1-enyl]-2,4-dichloro-6-ethylpyrimidine (PubChem CID 155058641) has the molecular formula C10H12Cl2N2
and a molecular weight of 231.13 g/mol. Its IUPAC name is 5-[(Z)-but-1-enyl]-2,4-dichloro-6-ethylpyrimidine.
Molecular Properties
| Compound Name | 5-[(Z)-but-1-enyl]-2,4-dichloro-6-ethylpyrimidine |
| PubChem CID | 155058641 |
| Molecular Formula | C10H12Cl2N2 |
| Molecular Weight | 231.13 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 5-[(Z)-but-1-enyl]-2,4-dichloro-6-ethylpyrimidine |
| SMILES | CC/C=C\c1c(Cl)nc(Cl)nc1CC |
| InChI | InChI=1S/C10H12Cl2N2/c1-3-5-6-7-8(4-2)13-10(12)14-9(7)11/h5-6H,3-4H2,1-2H3/b6-5- |
| InChIKey | RYHOVAPXRWKPHP-WAYWQWQTSA-N |
| XLogP | 3.77 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.13 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(Z)-but-1-enyl]-2,4-dichloro-6-ethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(Z)-but-1-enyl]-2,4-dichloro-6-ethylpyrimidine?
The IUPAC name of 5-[(Z)-but-1-enyl]-2,4-dichloro-6-ethylpyrimidine (CID 155058641) is 5-[(Z)-but-1-enyl]-2,4-dichloro-6-ethylpyrimidine.
What is the SMILES notation for 5-[(Z)-but-1-enyl]-2,4-dichloro-6-ethylpyrimidine?
The canonical SMILES for 5-[(Z)-but-1-enyl]-2,4-dichloro-6-ethylpyrimidine is CC/C=C\c1c(Cl)nc(Cl)nc1CC.
What is the InChIKey of 5-[(Z)-but-1-enyl]-2,4-dichloro-6-ethylpyrimidine?
The InChIKey is RYHOVAPXRWKPHP-WAYWQWQTSA-N. The full InChI is InChI=1S/C10H12Cl2N2/c1-3-5-6-7-8(4-2)13-10(12)14-9(7)11/h5-6H,3-4H2,1-2H3/b6-5-.
What are the key properties of 5-[(Z)-but-1-enyl]-2,4-dichloro-6-ethylpyrimidine?
5-[(Z)-but-1-enyl]-2,4-dichloro-6-ethylpyrimidine has a molecular weight of 231.13 g/mol, XLogP of 3.77, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(Z)-but-1-enyl]-2,4-dichloro-6-ethylpyrimidine is sourced from PubChem (CID 155058641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).