About 3-[(2,5-dioxopyrrol-1-yl)amino]-2,2-dimethylpropanal
3-[(2,5-dioxopyrrol-1-yl)amino]-2,2-dimethylpropanal (PubChem CID 155058688) has the molecular formula C9H12N2O3
and a molecular weight of 196.21 g/mol. Its IUPAC name is 3-[(2,5-dioxopyrrol-1-yl)amino]-2,2-dimethylpropanal.
Molecular Properties
| Compound Name | 3-[(2,5-dioxopyrrol-1-yl)amino]-2,2-dimethylpropanal |
| PubChem CID | 155058688 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 3-[(2,5-dioxopyrrol-1-yl)amino]-2,2-dimethylpropanal |
| SMILES | CC(C)(C=O)CNN1C(=O)C=CC1=O |
| InChI | InChI=1S/C9H12N2O3/c1-9(2,6-12)5-10-11-7(13)3-4-8(11)14/h3-4,6,10H,5H2,1-2H3 |
| InChIKey | XDRJLKOBCIZERN-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2,5-dioxopyrrol-1-yl)amino]-2,2-dimethylpropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,5-dioxopyrrol-1-yl)amino]-2,2-dimethylpropanal?
The IUPAC name of 3-[(2,5-dioxopyrrol-1-yl)amino]-2,2-dimethylpropanal (CID 155058688) is 3-[(2,5-dioxopyrrol-1-yl)amino]-2,2-dimethylpropanal.
What is the SMILES notation for 3-[(2,5-dioxopyrrol-1-yl)amino]-2,2-dimethylpropanal?
The canonical SMILES for 3-[(2,5-dioxopyrrol-1-yl)amino]-2,2-dimethylpropanal is CC(C)(C=O)CNN1C(=O)C=CC1=O.
What is the InChIKey of 3-[(2,5-dioxopyrrol-1-yl)amino]-2,2-dimethylpropanal?
The InChIKey is XDRJLKOBCIZERN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3/c1-9(2,6-12)5-10-11-7(13)3-4-8(11)14/h3-4,6,10H,5H2,1-2H3.
What are the key properties of 3-[(2,5-dioxopyrrol-1-yl)amino]-2,2-dimethylpropanal?
3-[(2,5-dioxopyrrol-1-yl)amino]-2,2-dimethylpropanal has a molecular weight of 196.21 g/mol, XLogP of -0.36, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,5-dioxopyrrol-1-yl)amino]-2,2-dimethylpropanal is sourced from PubChem (CID 155058688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).