C27H34F3IN6O3 — CID 155059175
4-[ethyl-[2-iodo-1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]-N-[(4-methoxy-6-methyl-2-oxo-1H-pyridin-3-yl)methyl]-2,5-dimethylindazole-6-carboxamide (PubChem CID 155059175) has the molecular formula C27H34F3IN6O3 and a molecular weight of 674.51 g/mol. Its IUPAC name is 4-[ethyl-[2-iodo-1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]-N-[(4-methoxy-6-methyl-2-oxo-1H-pyridin-3-yl)methyl]-2,5-dimethylindazole-6-carboxamide.
| Compound Name | 4-[ethyl-[2-iodo-1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]-N-[(4-methoxy-6-methyl-2-oxo-1H-pyridin-3-yl)methyl]-2,5-dimethylindazole-6-carboxamide |
|---|---|
| PubChem CID | 155059175 |
| Molecular Formula | C27H34F3IN6O3 |
| Molecular Weight | 674.51 g/mol |
| Exact Mass | 674.17 |
| IUPAC Name | 4-[ethyl-[2-iodo-1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]-N-[(4-methoxy-6-methyl-2-oxo-1H-pyridin-3-yl)methyl]-2,5-dimethylindazole-6-carboxamide |
| SMILES | CCN(c1c(C)c(C(=O)NCc2c(OC)cc(C)[nH]c2=O)cc2nn(C)cc12)C1CCN(CC(F)(F)F)C(I)C1 |
| InChI | InChI=1S/C27H34F3IN6O3/c1-6-37(17-7-8-36(23(31)10-17)14-27(28,29)30)24-16(3)18(11-21-20(24)13-35(4)34-21)25(38)32-12-19-22(40-5)9-15(2)33-26(19)39/h9,11,13,17,23H,6-8,10,12,14H2,1-5H3,(H,32,38)(H,33,39) |
| InChIKey | LEDFRTIBZVCRRX-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 95.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.51 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|