About 3-hydroxypyrrolidine-2,5-dione;phosphane
3-hydroxypyrrolidine-2,5-dione;phosphane (PubChem CID 155059355) has the molecular formula C4H8NO3P
and a molecular weight of 149.09 g/mol. Its IUPAC name is 3-hydroxypyrrolidine-2,5-dione;phosphane.
Molecular Properties
| Compound Name | 3-hydroxypyrrolidine-2,5-dione;phosphane |
| PubChem CID | 155059355 |
| Molecular Formula | C4H8NO3P |
| Molecular Weight | 149.09 g/mol |
| Exact Mass | 149.02 |
| IUPAC Name | 3-hydroxypyrrolidine-2,5-dione;phosphane |
| SMILES | O=C1CC(O)C(=O)N1.P |
| InChI | InChI=1S/C4H5NO3.H3P/c6-2-1-3(7)5-4(2)8;/h2,6H,1H2,(H,5,7,8);1H3 |
| InChIKey | PYOOIKXGFSACFU-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.09 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxypyrrolidine-2,5-dione;phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxypyrrolidine-2,5-dione;phosphane?
The IUPAC name of 3-hydroxypyrrolidine-2,5-dione;phosphane (CID 155059355) is 3-hydroxypyrrolidine-2,5-dione;phosphane.
What is the SMILES notation for 3-hydroxypyrrolidine-2,5-dione;phosphane?
The canonical SMILES for 3-hydroxypyrrolidine-2,5-dione;phosphane is O=C1CC(O)C(=O)N1.P.
What is the InChIKey of 3-hydroxypyrrolidine-2,5-dione;phosphane?
The InChIKey is PYOOIKXGFSACFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO3.H3P/c6-2-1-3(7)5-4(2)8;/h2,6H,1H2,(H,5,7,8);1H3.
What are the key properties of 3-hydroxypyrrolidine-2,5-dione;phosphane?
3-hydroxypyrrolidine-2,5-dione;phosphane has a molecular weight of 149.09 g/mol, XLogP of -1.55, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxypyrrolidine-2,5-dione;phosphane is sourced from PubChem (CID 155059355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).