About (2,5-dioxopyrrolidin-1-yl) 3-[(2,4-dimethoxyphenyl)-hydroxy-pyren-1-ylmethyl]benzoate
(2,5-dioxopyrrolidin-1-yl) 3-[(2,4-dimethoxyphenyl)-hydroxy-pyren-1-ylmethyl]benzoate (PubChem CID 15505946) has the molecular formula C36H27NO7
and a molecular weight of 585.61 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[(2,4-dimethoxyphenyl)-hydroxy-pyren-1-ylmethyl]benzoate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[(2,4-dimethoxyphenyl)-hydroxy-pyren-1-ylmethyl]benzoate |
| PubChem CID | 15505946 |
| Molecular Formula | C36H27NO7 |
| Molecular Weight | 585.61 g/mol |
| Exact Mass | 585.18 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[(2,4-dimethoxyphenyl)-hydroxy-pyren-1-ylmethyl]benzoate |
| SMILES | COc1ccc(C(O)(c2cccc(C(=O)ON3C(=O)CCC3=O)c2)c2ccc3ccc4cccc5ccc2c3c45)c(OC)c1 |
| InChI | InChI=1S/C36H27NO7/c1-42-26-13-16-29(30(20-26)43-2)36(41,25-8-4-7-24(19-25)35(40)44-37-31(38)17-18-32(37)39)28-15-12-23-10-9-21-5-3-6-22-11-14-27(28)34(23)33(21)22/h3-16,19-20,41H,17-18H2,1-2H3 |
| InChIKey | FYNHSBLRRMHJDR-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 585.61 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) 3-[(2,4-dimethoxyphenyl)-hydroxy-pyren-1-ylmethyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) 3-[(2,4-dimethoxyphenyl)-hydroxy-pyren-1-ylmethyl]benzoate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) 3-[(2,4-dimethoxyphenyl)-hydroxy-pyren-1-ylmethyl]benzoate (CID 15505946) is (2,5-dioxopyrrolidin-1-yl) 3-[(2,4-dimethoxyphenyl)-hydroxy-pyren-1-ylmethyl]benzoate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) 3-[(2,4-dimethoxyphenyl)-hydroxy-pyren-1-ylmethyl]benzoate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) 3-[(2,4-dimethoxyphenyl)-hydroxy-pyren-1-ylmethyl]benzoate is COc1ccc(C(O)(c2cccc(C(=O)ON3C(=O)CCC3=O)c2)c2ccc3ccc4cccc5ccc2c3c45)c(OC)c1.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) 3-[(2,4-dimethoxyphenyl)-hydroxy-pyren-1-ylmethyl]benzoate?
The InChIKey is FYNHSBLRRMHJDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H27NO7/c1-42-26-13-16-29(30(20-26)43-2)36(41,25-8-4-7-24(19-25)35(40)44-37-31(38)17-18-32(37)39)28-15-12-23-10-9-21-5-3-6-22-11-14-27(28)34(23)33(21)22/h3-16,19-20,41H,17-18H2,1-2H3.
What are the key properties of (2,5-dioxopyrrolidin-1-yl) 3-[(2,4-dimethoxyphenyl)-hydroxy-pyren-1-ylmethyl]benzoate?
(2,5-dioxopyrrolidin-1-yl) 3-[(2,4-dimethoxyphenyl)-hydroxy-pyren-1-ylmethyl]benzoate has a molecular weight of 585.61 g/mol, XLogP of 6.11, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) 3-[(2,4-dimethoxyphenyl)-hydroxy-pyren-1-ylmethyl]benzoate is sourced from PubChem (CID 15505946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).