C22H34ClN4O7S+ — CID 155059607
[1-[2-chloro-5-[[3,4-dioxo-2-(pentan-3-ylamino)cyclobuten-1-yl]amino]-4-hydroxy-3-[methoxy(methyl)sulfamoyl]phenyl]-2-hydroxyethyl]-trimethylazanium (PubChem CID 155059607) has the molecular formula C22H34ClN4O7S+ and a molecular weight of 534.06 g/mol. Its IUPAC name is [1-[2-chloro-5-[[3,4-dioxo-2-(pentan-3-ylamino)cyclobuten-1-yl]amino]-4-hydroxy-3-[methoxy(methyl)sulfamoyl]phenyl]-2-hydroxyethyl]-trimethylazanium.
| Compound Name | [1-[2-chloro-5-[[3,4-dioxo-2-(pentan-3-ylamino)cyclobuten-1-yl]amino]-4-hydroxy-3-[methoxy(methyl)sulfamoyl]phenyl]-2-hydroxyethyl]-trimethylazanium |
|---|---|
| PubChem CID | 155059607 |
| Molecular Formula | C22H34ClN4O7S+ |
| Molecular Weight | 534.06 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | [1-[2-chloro-5-[[3,4-dioxo-2-(pentan-3-ylamino)cyclobuten-1-yl]amino]-4-hydroxy-3-[methoxy(methyl)sulfamoyl]phenyl]-2-hydroxyethyl]-trimethylazanium |
| SMILES | CCC(CC)Nc1c(Nc2cc(C(CO)[N+](C)(C)C)c(Cl)c(S(=O)(=O)N(C)OC)c2O)c(=O)c1=O |
| InChI | InChI=1S/C22H33ClN4O7S/c1-8-12(9-2)24-17-18(21(31)20(17)30)25-14-10-13(15(11-28)27(4,5)6)16(23)22(19(14)29)35(32,33)26(3)34-7/h10,12,15,28H,8-9,11H2,1-7H3,(H2-,24,25,29,30,31)/p+1 |
| InChIKey | XCEMPWAAKRBBGO-UHFFFAOYSA-O |
| XLogP | 1.91 |
| TPSA | 145.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.06 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|