About 2-[5-chloro-7-(furan-2-ylmethylamino)-3-methylthieno[3,2-b]pyridin-2-yl]ethanol
2-[5-chloro-7-(furan-2-ylmethylamino)-3-methylthieno[3,2-b]pyridin-2-yl]ethanol (PubChem CID 155059992) has the molecular formula C15H15ClN2O2S
and a molecular weight of 322.82 g/mol. Its IUPAC name is 2-[5-chloro-7-(furan-2-ylmethylamino)-3-methylthieno[3,2-b]pyridin-2-yl]ethanol.
Molecular Properties
| Compound Name | 2-[5-chloro-7-(furan-2-ylmethylamino)-3-methylthieno[3,2-b]pyridin-2-yl]ethanol |
| PubChem CID | 155059992 |
| Molecular Formula | C15H15ClN2O2S |
| Molecular Weight | 322.82 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 2-[5-chloro-7-(furan-2-ylmethylamino)-3-methylthieno[3,2-b]pyridin-2-yl]ethanol |
| SMILES | Cc1c(CCO)sc2c(NCc3ccco3)cc(Cl)nc12 |
| InChI | InChI=1S/C15H15ClN2O2S/c1-9-12(4-5-19)21-15-11(7-13(16)18-14(9)15)17-8-10-3-2-6-20-10/h2-3,6-7,19H,4-5,8H2,1H3,(H,17,18) |
| InChIKey | LICJUVUSOURKCD-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.82 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-chloro-7-(furan-2-ylmethylamino)-3-methylthieno[3,2-b]pyridin-2-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-chloro-7-(furan-2-ylmethylamino)-3-methylthieno[3,2-b]pyridin-2-yl]ethanol?
The IUPAC name of 2-[5-chloro-7-(furan-2-ylmethylamino)-3-methylthieno[3,2-b]pyridin-2-yl]ethanol (CID 155059992) is 2-[5-chloro-7-(furan-2-ylmethylamino)-3-methylthieno[3,2-b]pyridin-2-yl]ethanol.
What is the SMILES notation for 2-[5-chloro-7-(furan-2-ylmethylamino)-3-methylthieno[3,2-b]pyridin-2-yl]ethanol?
The canonical SMILES for 2-[5-chloro-7-(furan-2-ylmethylamino)-3-methylthieno[3,2-b]pyridin-2-yl]ethanol is Cc1c(CCO)sc2c(NCc3ccco3)cc(Cl)nc12.
What is the InChIKey of 2-[5-chloro-7-(furan-2-ylmethylamino)-3-methylthieno[3,2-b]pyridin-2-yl]ethanol?
The InChIKey is LICJUVUSOURKCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15ClN2O2S/c1-9-12(4-5-19)21-15-11(7-13(16)18-14(9)15)17-8-10-3-2-6-20-10/h2-3,6-7,19H,4-5,8H2,1H3,(H,17,18).
What are the key properties of 2-[5-chloro-7-(furan-2-ylmethylamino)-3-methylthieno[3,2-b]pyridin-2-yl]ethanol?
2-[5-chloro-7-(furan-2-ylmethylamino)-3-methylthieno[3,2-b]pyridin-2-yl]ethanol has a molecular weight of 322.82 g/mol, XLogP of 4.00, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-chloro-7-(furan-2-ylmethylamino)-3-methylthieno[3,2-b]pyridin-2-yl]ethanol is sourced from PubChem (CID 155059992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).