About 5-chloro-N-(furan-2-ylmethyl)-3-methyl-2-propan-2-ylthieno[3,2-b]pyridin-7-amine
5-chloro-N-(furan-2-ylmethyl)-3-methyl-2-propan-2-ylthieno[3,2-b]pyridin-7-amine (PubChem CID 155060025) has the molecular formula C16H17ClN2OS
and a molecular weight of 320.85 g/mol. Its IUPAC name is 5-chloro-N-(furan-2-ylmethyl)-3-methyl-2-propan-2-ylthieno[3,2-b]pyridin-7-amine.
Molecular Properties
| Compound Name | 5-chloro-N-(furan-2-ylmethyl)-3-methyl-2-propan-2-ylthieno[3,2-b]pyridin-7-amine |
| PubChem CID | 155060025 |
| Molecular Formula | C16H17ClN2OS |
| Molecular Weight | 320.85 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 5-chloro-N-(furan-2-ylmethyl)-3-methyl-2-propan-2-ylthieno[3,2-b]pyridin-7-amine |
| SMILES | Cc1c(C(C)C)sc2c(NCc3ccco3)cc(Cl)nc12 |
| InChI | InChI=1S/C16H17ClN2OS/c1-9(2)15-10(3)14-16(21-15)12(7-13(17)19-14)18-8-11-5-4-6-20-11/h4-7,9H,8H2,1-3H3,(H,18,19) |
| InChIKey | PQLNCVVHEPASFI-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.85 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-N-(furan-2-ylmethyl)-3-methyl-2-propan-2-ylthieno[3,2-b]pyridin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-(furan-2-ylmethyl)-3-methyl-2-propan-2-ylthieno[3,2-b]pyridin-7-amine?
The IUPAC name of 5-chloro-N-(furan-2-ylmethyl)-3-methyl-2-propan-2-ylthieno[3,2-b]pyridin-7-amine (CID 155060025) is 5-chloro-N-(furan-2-ylmethyl)-3-methyl-2-propan-2-ylthieno[3,2-b]pyridin-7-amine.
What is the SMILES notation for 5-chloro-N-(furan-2-ylmethyl)-3-methyl-2-propan-2-ylthieno[3,2-b]pyridin-7-amine?
The canonical SMILES for 5-chloro-N-(furan-2-ylmethyl)-3-methyl-2-propan-2-ylthieno[3,2-b]pyridin-7-amine is Cc1c(C(C)C)sc2c(NCc3ccco3)cc(Cl)nc12.
What is the InChIKey of 5-chloro-N-(furan-2-ylmethyl)-3-methyl-2-propan-2-ylthieno[3,2-b]pyridin-7-amine?
The InChIKey is PQLNCVVHEPASFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17ClN2OS/c1-9(2)15-10(3)14-16(21-15)12(7-13(17)19-14)18-8-11-5-4-6-20-11/h4-7,9H,8H2,1-3H3,(H,18,19).
What are the key properties of 5-chloro-N-(furan-2-ylmethyl)-3-methyl-2-propan-2-ylthieno[3,2-b]pyridin-7-amine?
5-chloro-N-(furan-2-ylmethyl)-3-methyl-2-propan-2-ylthieno[3,2-b]pyridin-7-amine has a molecular weight of 320.85 g/mol, XLogP of 5.59, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-(furan-2-ylmethyl)-3-methyl-2-propan-2-ylthieno[3,2-b]pyridin-7-amine is sourced from PubChem (CID 155060025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).