C25H29N3O4 — CID 155060769
[3-[cyclopropanecarbonyl-[[4-(3-methyl-1,2,4-oxadiazol-5-yl)-1-bicyclo[2.2.2]octanyl]methyl]amino]phenyl] prop-2-enoate (PubChem CID 155060769) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is [3-[cyclopropanecarbonyl-[[4-(3-methyl-1,2,4-oxadiazol-5-yl)-1-bicyclo[2.2.2]octanyl]methyl]amino]phenyl] prop-2-enoate.
| Compound Name | [3-[cyclopropanecarbonyl-[[4-(3-methyl-1,2,4-oxadiazol-5-yl)-1-bicyclo[2.2.2]octanyl]methyl]amino]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 155060769 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | [3-[cyclopropanecarbonyl-[[4-(3-methyl-1,2,4-oxadiazol-5-yl)-1-bicyclo[2.2.2]octanyl]methyl]amino]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1cccc(N(CC23CCC(c4nc(C)no4)(CC2)CC3)C(=O)C2CC2)c1 |
| InChI | InChI=1S/C25H29N3O4/c1-3-21(29)31-20-6-4-5-19(15-20)28(22(30)18-7-8-18)16-24-9-12-25(13-10-24,14-11-24)23-26-17(2)27-32-23/h3-6,15,18H,1,7-14,16H2,2H3 |
| InChIKey | ZUTBILAQQGUSKP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|