C21H23F3O6S — CID 155061268
[(3R,4R,5R)-2-methyl-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl] trifluoromethanesulfonate (PubChem CID 155061268) has the molecular formula C21H23F3O6S and a molecular weight of 460.47 g/mol. Its IUPAC name is [(3R,4R,5R)-2-methyl-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl] trifluoromethanesulfonate.
| Compound Name | [(3R,4R,5R)-2-methyl-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 155061268 |
| Molecular Formula | C21H23F3O6S |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | [(3R,4R,5R)-2-methyl-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl] trifluoromethanesulfonate |
| SMILES | CC1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C21H23F3O6S/c1-15-19(30-31(25,26)21(22,23)24)20(28-13-17-10-6-3-7-11-17)18(29-15)14-27-12-16-8-4-2-5-9-16/h2-11,15,18-20H,12-14H2,1H3/t15?,18-,19-,20-/m1/s1 |
| InChIKey | MDOUZIQEWVUSNC-NKSDPYKRSA-N |
| XLogP | 3.81 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|