C19H32O4 — CID 155061446
[(E,1S)-1-[(4R)-2-ethenyl-6-ethyl-5,5-dimethyl-1,3-dioxan-4-yl]-2,3-dimethylpent-2-enyl] acetate (PubChem CID 155061446) has the molecular formula C19H32O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is [(E,1S)-1-[(4R)-2-ethenyl-6-ethyl-5,5-dimethyl-1,3-dioxan-4-yl]-2,3-dimethylpent-2-enyl] acetate.
| Compound Name | [(E,1S)-1-[(4R)-2-ethenyl-6-ethyl-5,5-dimethyl-1,3-dioxan-4-yl]-2,3-dimethylpent-2-enyl] acetate |
|---|---|
| PubChem CID | 155061446 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | [(E,1S)-1-[(4R)-2-ethenyl-6-ethyl-5,5-dimethyl-1,3-dioxan-4-yl]-2,3-dimethylpent-2-enyl] acetate |
| SMILES | C=CC1OC(CC)C(C)(C)[C@H]([C@@H](OC(C)=O)/C(C)=C(\C)CC)O1 |
| InChI | InChI=1S/C19H32O4/c1-9-12(4)13(5)17(21-14(6)20)18-19(7,8)15(10-2)22-16(11-3)23-18/h11,15-18H,3,9-10H2,1-2,4-8H3/b13-12+/t15?,16?,17-,18-/m0/s1 |
| InChIKey | XCXBBCMMFJDFFL-LXVNABPISA-N |
| XLogP | 4.40 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|