C11H17N5 — CID 155061515
7-hexan-3-ylimidazo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 155061515) has the molecular formula C11H17N5 and a molecular weight of 219.29 g/mol. Its IUPAC name is 7-hexan-3-ylimidazo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 7-hexan-3-ylimidazo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 155061515 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 7-hexan-3-ylimidazo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | CCCC(CC)c1cnc2c(N)ncnn12 |
| InChI | InChI=1S/C11H17N5/c1-3-5-8(4-2)9-6-13-11-10(12)14-7-15-16(9)11/h6-8H,3-5H2,1-2H3,(H2,12,14,15) |
| InChIKey | IWVJAOLKIPIQQC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |