C14H28O4 — CID 15506241
[(3R,4R,5R,6R,7R)-5,7-dihydroxy-4,6-dimethylnonan-3-yl] propanoate (PubChem CID 15506241) has the molecular formula C14H28O4 and a molecular weight of 260.37 g/mol. Its IUPAC name is [(3R,4R,5R,6R,7R)-5,7-dihydroxy-4,6-dimethylnonan-3-yl] propanoate.
| Compound Name | [(3R,4R,5R,6R,7R)-5,7-dihydroxy-4,6-dimethylnonan-3-yl] propanoate |
|---|---|
| PubChem CID | 15506241 |
| Molecular Formula | C14H28O4 |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | [(3R,4R,5R,6R,7R)-5,7-dihydroxy-4,6-dimethylnonan-3-yl] propanoate |
| SMILES | CCC(=O)O[C@H](CC)[C@H](C)[C@H](O)[C@H](C)[C@H](O)CC |
| InChI | InChI=1S/C14H28O4/c1-6-11(15)9(4)14(17)10(5)12(7-2)18-13(16)8-3/h9-12,14-15,17H,6-8H2,1-5H3/t9-,10+,11-,12-,14-/m1/s1 |
| InChIKey | YQIQZHLNHJLGHQ-CYRBOEJBSA-N |
| XLogP | 2.12 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |