C17H29FN2O — CID 155062434
N-[(1-ethyl-4-fluoropiperidin-4-yl)methyl]-2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxyethanamine (PubChem CID 155062434) has the molecular formula C17H29FN2O and a molecular weight of 296.43 g/mol. Its IUPAC name is N-[(1-ethyl-4-fluoropiperidin-4-yl)methyl]-2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxyethanamine.
| Compound Name | N-[(1-ethyl-4-fluoropiperidin-4-yl)methyl]-2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxyethanamine |
|---|---|
| PubChem CID | 155062434 |
| Molecular Formula | C17H29FN2O |
| Molecular Weight | 296.43 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | N-[(1-ethyl-4-fluoropiperidin-4-yl)methyl]-2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxyethanamine |
| SMILES | C=C/C=C\C(=C/C)OCCNCC1(F)CCN(CC)CC1 |
| InChI | InChI=1S/C17H29FN2O/c1-4-7-8-16(5-2)21-14-11-19-15-17(18)9-12-20(6-3)13-10-17/h4-5,7-8,19H,1,6,9-15H2,2-3H3/b8-7-,16-5+ |
| InChIKey | JCUMGHUEUNXNIK-OPMQWOTMSA-N |
| XLogP | 3.06 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|