About N-ethyl-1-(4-ethyl-1-bicyclo[3.1.0]hex-4-enyl)-N'-methylideneethane-1,2-diimine
N-ethyl-1-(4-ethyl-1-bicyclo[3.1.0]hex-4-enyl)-N'-methylideneethane-1,2-diimine (PubChem CID 155063104) has the molecular formula C13H20N2
and a molecular weight of 204.32 g/mol. Its IUPAC name is N-ethyl-1-(4-ethyl-1-bicyclo[3.1.0]hex-4-enyl)-N'-methylideneethane-1,2-diimine.
Molecular Properties
| Compound Name | N-ethyl-1-(4-ethyl-1-bicyclo[3.1.0]hex-4-enyl)-N'-methylideneethane-1,2-diimine |
| PubChem CID | 155063104 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | N-ethyl-1-(4-ethyl-1-bicyclo[3.1.0]hex-4-enyl)-N'-methylideneethane-1,2-diimine |
| SMILES | C=NC/C(=N\CC)C12CCC(CC)=C1C2 |
| InChI | InChI=1S/C13H20N2/c1-4-10-6-7-13(8-11(10)13)12(9-14-3)15-5-2/h3-9H2,1-2H3/b15-12+ |
| InChIKey | BWBPFZFOZFUDIO-NTCAYCPXSA-N |
| XLogP | 3.04 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-1-(4-ethyl-1-bicyclo[3.1.0]hex-4-enyl)-N'-methylideneethane-1,2-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-1-(4-ethyl-1-bicyclo[3.1.0]hex-4-enyl)-N'-methylideneethane-1,2-diimine?
The IUPAC name of N-ethyl-1-(4-ethyl-1-bicyclo[3.1.0]hex-4-enyl)-N'-methylideneethane-1,2-diimine (CID 155063104) is N-ethyl-1-(4-ethyl-1-bicyclo[3.1.0]hex-4-enyl)-N'-methylideneethane-1,2-diimine.
What is the SMILES notation for N-ethyl-1-(4-ethyl-1-bicyclo[3.1.0]hex-4-enyl)-N'-methylideneethane-1,2-diimine?
The canonical SMILES for N-ethyl-1-(4-ethyl-1-bicyclo[3.1.0]hex-4-enyl)-N'-methylideneethane-1,2-diimine is C=NC/C(=N\CC)C12CCC(CC)=C1C2.
What is the InChIKey of N-ethyl-1-(4-ethyl-1-bicyclo[3.1.0]hex-4-enyl)-N'-methylideneethane-1,2-diimine?
The InChIKey is BWBPFZFOZFUDIO-NTCAYCPXSA-N. The full InChI is InChI=1S/C13H20N2/c1-4-10-6-7-13(8-11(10)13)12(9-14-3)15-5-2/h3-9H2,1-2H3/b15-12+.
What are the key properties of N-ethyl-1-(4-ethyl-1-bicyclo[3.1.0]hex-4-enyl)-N'-methylideneethane-1,2-diimine?
N-ethyl-1-(4-ethyl-1-bicyclo[3.1.0]hex-4-enyl)-N'-methylideneethane-1,2-diimine has a molecular weight of 204.32 g/mol, XLogP of 3.04, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-1-(4-ethyl-1-bicyclo[3.1.0]hex-4-enyl)-N'-methylideneethane-1,2-diimine is sourced from PubChem (CID 155063104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).