C32H39N5O5S — CID 155063167
N-[[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-2-bicyclo[3.3.1]nonanyl]methyl]-N-[3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)phenyl]-1,1-dioxothiane-4-carboxamide (PubChem CID 155063167) has the molecular formula C32H39N5O5S and a molecular weight of 605.76 g/mol. Its IUPAC name is N-[[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-2-bicyclo[3.3.1]nonanyl]methyl]-N-[3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)phenyl]-1,1-dioxothiane-4-carboxamide.
| Compound Name | N-[[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-2-bicyclo[3.3.1]nonanyl]methyl]-N-[3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)phenyl]-1,1-dioxothiane-4-carboxamide |
|---|---|
| PubChem CID | 155063167 |
| Molecular Formula | C32H39N5O5S |
| Molecular Weight | 605.76 g/mol |
| Exact Mass | 605.27 |
| IUPAC Name | N-[[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-2-bicyclo[3.3.1]nonanyl]methyl]-N-[3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)phenyl]-1,1-dioxothiane-4-carboxamide |
| SMILES | O=C(C1CCS(=O)(=O)CC1)N(CC1CCC2(c3nc(C4CC4)no3)CCCC1C2)c1cccc(-c2nc(C3CC3)no2)c1 |
| InChI | InChI=1S/C32H39N5O5S/c38-30(22-11-15-43(39,40)16-12-22)37(26-5-1-3-23(17-26)29-33-27(35-41-29)20-6-7-20)19-25-10-14-32(13-2-4-24(25)18-32)31-34-28(36-42-31)21-8-9-21/h1,3,5,17,20-22,24-25H,2,4,6-16,18-19H2 |
| InChIKey | WUOKNAYNQWYBAN-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 132.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.76 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |