C25H32N6OS — CID 155063715
1-[3-[4-[(4-ethylpiperazin-1-yl)methyl]-6-[(5-methyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]anilino]prop-2-en-1-ol (PubChem CID 155063715) has the molecular formula C25H32N6OS and a molecular weight of 464.64 g/mol. Its IUPAC name is 1-[3-[4-[(4-ethylpiperazin-1-yl)methyl]-6-[(5-methyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]anilino]prop-2-en-1-ol.
| Compound Name | 1-[3-[4-[(4-ethylpiperazin-1-yl)methyl]-6-[(5-methyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]anilino]prop-2-en-1-ol |
|---|---|
| PubChem CID | 155063715 |
| Molecular Formula | C25H32N6OS |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | 1-[3-[4-[(4-ethylpiperazin-1-yl)methyl]-6-[(5-methyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]anilino]prop-2-en-1-ol |
| SMILES | C=CC(O)Nc1cccc(-c2cc(CN3CCN(CC)CC3)cc(Nc3ncc(C)s3)n2)c1 |
| InChI | InChI=1S/C25H32N6OS/c1-4-24(32)27-21-8-6-7-20(15-21)22-13-19(17-31-11-9-30(5-2)10-12-31)14-23(28-22)29-25-26-16-18(3)33-25/h4,6-8,13-16,24,27,32H,1,5,9-12,17H2,2-3H3,(H,26,28,29) |
| InChIKey | FCZJMFZQGGDGGU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 76.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|