C35H36F5N3O3 — CID 155064174
N-[[4-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-1-bicyclo[2.2.2]octanyl]methyl]-4-fluoro-N-[3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]bicyclo[2.1.1]hexane-2-carboxamide (PubChem CID 155064174) has the molecular formula C35H36F5N3O3 and a molecular weight of 641.68 g/mol. Its IUPAC name is N-[[4-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-1-bicyclo[2.2.2]octanyl]methyl]-4-fluoro-N-[3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]bicyclo[2.1.1]hexane-2-carboxamide.
| Compound Name | N-[[4-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-1-bicyclo[2.2.2]octanyl]methyl]-4-fluoro-N-[3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]bicyclo[2.1.1]hexane-2-carboxamide |
|---|---|
| PubChem CID | 155064174 |
| Molecular Formula | C35H36F5N3O3 |
| Molecular Weight | 641.68 g/mol |
| Exact Mass | 641.27 |
| IUPAC Name | N-[[4-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-1-bicyclo[2.2.2]octanyl]methyl]-4-fluoro-N-[3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]bicyclo[2.1.1]hexane-2-carboxamide |
| SMILES | O=C(C1CC2(F)CC1C2)N(CC12CCC(c3nc(C4CC4)no3)(CC1)CC2)c1cccc(-c2cccc(OC(F)(F)C(F)F)c2)c1 |
| InChI | InChI=1S/C35H36F5N3O3/c36-30(37)35(39,40)45-26-6-2-4-23(16-26)22-3-1-5-25(15-22)43(29(44)27-19-34(38)17-24(27)18-34)20-32-9-12-33(13-10-32,14-11-32)31-41-28(42-46-31)21-7-8-21/h1-6,15-16,21,24,27,30H,7-14,17-20H2 |
| InChIKey | DBBXPMJVSXVGKR-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.68 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|