C27H35N3O8 — CID 155064607
[(3R,5S,6S,7S,10R,11S,12Z,14E)-21-amino-5,11-dimethoxy-3,7,15-trimethyl-16,20,22-trioxo-23-oxa-17-azatricyclo[16.3.1.16,9]tricosa-1(21),8,12,14,18-pentaen-10-yl] carbamate (PubChem CID 155064607) has the molecular formula C27H35N3O8 and a molecular weight of 529.59 g/mol. Its IUPAC name is [(3R,5S,6S,7S,10R,11S,12Z,14E)-21-amino-5,11-dimethoxy-3,7,15-trimethyl-16,20,22-trioxo-23-oxa-17-azatricyclo[16.3.1.16,9]tricosa-1(21),8,12,14,18-pentaen-10-yl] carbamate.
| Compound Name | [(3R,5S,6S,7S,10R,11S,12Z,14E)-21-amino-5,11-dimethoxy-3,7,15-trimethyl-16,20,22-trioxo-23-oxa-17-azatricyclo[16.3.1.16,9]tricosa-1(21),8,12,14,18-pentaen-10-yl] carbamate |
|---|---|
| PubChem CID | 155064607 |
| Molecular Formula | C27H35N3O8 |
| Molecular Weight | 529.59 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | [(3R,5S,6S,7S,10R,11S,12Z,14E)-21-amino-5,11-dimethoxy-3,7,15-trimethyl-16,20,22-trioxo-23-oxa-17-azatricyclo[16.3.1.16,9]tricosa-1(21),8,12,14,18-pentaen-10-yl] carbamate |
| SMILES | CO[C@H]1/C=C\C=C(/C)C(=O)NC2=CC(=O)C(N)=C(C[C@@H](C)C[C@H](OC)[C@H]3OC(=C[C@@H]3C)[C@@H]1OC(N)=O)C2=O |
| InChI | InChI=1S/C27H35N3O8/c1-13-9-16-22(28)18(31)12-17(23(16)32)30-26(33)14(2)7-6-8-19(35-4)25(38-27(29)34)21-11-15(3)24(37-21)20(10-13)36-5/h6-8,11-13,15,19-20,24-25H,9-10,28H2,1-5H3,(H2,29,34)(H,30,33)/b8-6-,14-7+/t13-,15+,19+,20+,24+,25-/m1/s1 |
| InChIKey | RCCDFWMXLMXEJU-CGFKYNFMSA-N |
| XLogP | 1.70 |
| TPSA | 169.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.59 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|