C45H32N2 — CID 155064850
2-[9-[(1R)-cyclohexa-2,4-dien-1-yl]-10-(4-phenylphenyl)anthracen-2-yl]-1-phenylbenzimidazole (PubChem CID 155064850) has the molecular formula C45H32N2 and a molecular weight of 600.77 g/mol. Its IUPAC name is 2-[9-[(1R)-cyclohexa-2,4-dien-1-yl]-10-(4-phenylphenyl)anthracen-2-yl]-1-phenylbenzimidazole.
| Compound Name | 2-[9-[(1R)-cyclohexa-2,4-dien-1-yl]-10-(4-phenylphenyl)anthracen-2-yl]-1-phenylbenzimidazole |
|---|---|
| PubChem CID | 155064850 |
| Molecular Formula | C45H32N2 |
| Molecular Weight | 600.77 g/mol |
| Exact Mass | 600.26 |
| IUPAC Name | 2-[9-[(1R)-cyclohexa-2,4-dien-1-yl]-10-(4-phenylphenyl)anthracen-2-yl]-1-phenylbenzimidazole |
| SMILES | C1=CC[C@@H](c2c3ccccc3c(-c3ccc(-c4ccccc4)cc3)c3ccc(-c4nc5ccccc5n4-c4ccccc4)cc23)C=C1 |
| InChI | InChI=1S/C45H32N2/c1-4-14-31(15-5-1)32-24-26-34(27-25-32)43-37-20-10-11-21-38(37)44(33-16-6-2-7-17-33)40-30-35(28-29-39(40)43)45-46-41-22-12-13-23-42(41)47(45)36-18-8-3-9-19-36/h1-16,18-30,33H,17H2/t33-/m0/s1 |
| InChIKey | VDQRGNGHDBEKPV-XIFFEERXSA-N |
| XLogP | 11.93 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.77 |
| LogP ≤ 5 | 11.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|