C20H23NO5 — CID 15506553
dimethyl 2-(cyclohexylamino)-5-phenylfuran-3,4-dicarboxylate (PubChem CID 15506553) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is dimethyl 2-(cyclohexylamino)-5-phenylfuran-3,4-dicarboxylate.
| Compound Name | dimethyl 2-(cyclohexylamino)-5-phenylfuran-3,4-dicarboxylate |
|---|---|
| PubChem CID | 15506553 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | dimethyl 2-(cyclohexylamino)-5-phenylfuran-3,4-dicarboxylate |
| SMILES | COC(=O)c1c(NC2CCCCC2)oc(-c2ccccc2)c1C(=O)OC |
| InChI | InChI=1S/C20H23NO5/c1-24-19(22)15-16(20(23)25-2)18(21-14-11-7-4-8-12-14)26-17(15)13-9-5-3-6-10-13/h3,5-6,9-10,14,21H,4,7-8,11-12H2,1-2H3 |
| InChIKey | UJGMNLKGHQCTKM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |