About [1-[acetyl(methyl)amino]-2-methylpropan-2-yl] aminomethyl carbonate
[1-[acetyl(methyl)amino]-2-methylpropan-2-yl] aminomethyl carbonate (PubChem CID 155065549) has the molecular formula C9H18N2O4
and a molecular weight of 218.25 g/mol. Its IUPAC name is [1-[acetyl(methyl)amino]-2-methylpropan-2-yl] aminomethyl carbonate.
Molecular Properties
| Compound Name | [1-[acetyl(methyl)amino]-2-methylpropan-2-yl] aminomethyl carbonate |
| PubChem CID | 155065549 |
| Molecular Formula | C9H18N2O4 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | [1-[acetyl(methyl)amino]-2-methylpropan-2-yl] aminomethyl carbonate |
| SMILES | CC(=O)N(C)CC(C)(C)OC(=O)OCN |
| InChI | InChI=1S/C9H18N2O4/c1-7(12)11(4)5-9(2,3)15-8(13)14-6-10/h5-6,10H2,1-4H3 |
| InChIKey | HXEDKHFYSKXFQH-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [1-[acetyl(methyl)amino]-2-methylpropan-2-yl] aminomethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[acetyl(methyl)amino]-2-methylpropan-2-yl] aminomethyl carbonate?
The IUPAC name of [1-[acetyl(methyl)amino]-2-methylpropan-2-yl] aminomethyl carbonate (CID 155065549) is [1-[acetyl(methyl)amino]-2-methylpropan-2-yl] aminomethyl carbonate.
What is the SMILES notation for [1-[acetyl(methyl)amino]-2-methylpropan-2-yl] aminomethyl carbonate?
The canonical SMILES for [1-[acetyl(methyl)amino]-2-methylpropan-2-yl] aminomethyl carbonate is CC(=O)N(C)CC(C)(C)OC(=O)OCN.
What is the InChIKey of [1-[acetyl(methyl)amino]-2-methylpropan-2-yl] aminomethyl carbonate?
The InChIKey is HXEDKHFYSKXFQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O4/c1-7(12)11(4)5-9(2,3)15-8(13)14-6-10/h5-6,10H2,1-4H3.
What are the key properties of [1-[acetyl(methyl)amino]-2-methylpropan-2-yl] aminomethyl carbonate?
[1-[acetyl(methyl)amino]-2-methylpropan-2-yl] aminomethyl carbonate has a molecular weight of 218.25 g/mol, XLogP of 0.31, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[acetyl(methyl)amino]-2-methylpropan-2-yl] aminomethyl carbonate is sourced from PubChem (CID 155065549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).