C40H29F2N3S — CID 155066184
11-[3-[7-(2,6-difluoro-3-pyridinyl)-9,9-dimethylfluoren-2-yl]phenyl]-4-[(1Z,3Z)-penta-1,3-dienyl]-3-thia-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),4,7,9,11-pentaene (PubChem CID 155066184) has the molecular formula C40H29F2N3S and a molecular weight of 621.76 g/mol. Its IUPAC name is 11-[3-[7-(2,6-difluoro-3-pyridinyl)-9,9-dimethylfluoren-2-yl]phenyl]-4-[(1Z,3Z)-penta-1,3-dienyl]-3-thia-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),4,7,9,11-pentaene.
| Compound Name | 11-[3-[7-(2,6-difluoro-3-pyridinyl)-9,9-dimethylfluoren-2-yl]phenyl]-4-[(1Z,3Z)-penta-1,3-dienyl]-3-thia-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
|---|---|
| PubChem CID | 155066184 |
| Molecular Formula | C40H29F2N3S |
| Molecular Weight | 621.76 g/mol |
| Exact Mass | 621.21 |
| IUPAC Name | 11-[3-[7-(2,6-difluoro-3-pyridinyl)-9,9-dimethylfluoren-2-yl]phenyl]-4-[(1Z,3Z)-penta-1,3-dienyl]-3-thia-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
| SMILES | C/C=C\C=C/c1cc2nc3ccc(-c4cccc(-c5ccc6c(c5)C(C)(C)c5cc(-c7ccc(F)nc7F)ccc5-6)c4)cn3c2s1 |
| InChI | InChI=1S/C40H29F2N3S/c1-4-5-6-10-29-22-35-39(46-29)45-23-28(13-18-37(45)43-35)25-9-7-8-24(19-25)26-11-14-31-32-15-12-27(30-16-17-36(41)44-38(30)42)21-34(32)40(2,3)33(31)20-26/h4-23H,1-3H3/b5-4-,10-6- |
| InChIKey | WKBPLPXLLUSNTP-ARSRRCBKSA-N |
| XLogP | 11.12 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.76 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|