About 6-O-(2-ethoxy-2-oxoethyl) 1-O-ethyl hexanedioate
6-O-(2-ethoxy-2-oxoethyl) 1-O-ethyl hexanedioate (PubChem CID 155066194) has the molecular formula C12H20O6
and a molecular weight of 260.29 g/mol. Its IUPAC name is 6-O-(2-ethoxy-2-oxoethyl) 1-O-ethyl hexanedioate.
Molecular Properties
| Compound Name | 6-O-(2-ethoxy-2-oxoethyl) 1-O-ethyl hexanedioate |
| PubChem CID | 155066194 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 6-O-(2-ethoxy-2-oxoethyl) 1-O-ethyl hexanedioate |
| SMILES | CCOC(=O)CCCCC(=O)OCC(=O)OCC |
| InChI | InChI=1S/C12H20O6/c1-3-16-10(13)7-5-6-8-11(14)18-9-12(15)17-4-2/h3-9H2,1-2H3 |
| InChIKey | WGPJQOYXHNKLME-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-O-(2-ethoxy-2-oxoethyl) 1-O-ethyl hexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-O-(2-ethoxy-2-oxoethyl) 1-O-ethyl hexanedioate?
The IUPAC name of 6-O-(2-ethoxy-2-oxoethyl) 1-O-ethyl hexanedioate (CID 155066194) is 6-O-(2-ethoxy-2-oxoethyl) 1-O-ethyl hexanedioate.
What is the SMILES notation for 6-O-(2-ethoxy-2-oxoethyl) 1-O-ethyl hexanedioate?
The canonical SMILES for 6-O-(2-ethoxy-2-oxoethyl) 1-O-ethyl hexanedioate is CCOC(=O)CCCCC(=O)OCC(=O)OCC.
What is the InChIKey of 6-O-(2-ethoxy-2-oxoethyl) 1-O-ethyl hexanedioate?
The InChIKey is WGPJQOYXHNKLME-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O6/c1-3-16-10(13)7-5-6-8-11(14)18-9-12(15)17-4-2/h3-9H2,1-2H3.
What are the key properties of 6-O-(2-ethoxy-2-oxoethyl) 1-O-ethyl hexanedioate?
6-O-(2-ethoxy-2-oxoethyl) 1-O-ethyl hexanedioate has a molecular weight of 260.29 g/mol, XLogP of 1.22, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-O-(2-ethoxy-2-oxoethyl) 1-O-ethyl hexanedioate is sourced from PubChem (CID 155066194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).