About 4-[methyl-(2-methylsulfanyloxy-2-oxoethyl)amino]butan-2-yl 2-aminoacetate
4-[methyl-(2-methylsulfanyloxy-2-oxoethyl)amino]butan-2-yl 2-aminoacetate (PubChem CID 155066433) has the molecular formula C10H20N2O4S
and a molecular weight of 264.35 g/mol. Its IUPAC name is 4-[methyl-(2-methylsulfanyloxy-2-oxoethyl)amino]butan-2-yl 2-aminoacetate.
Molecular Properties
| Compound Name | 4-[methyl-(2-methylsulfanyloxy-2-oxoethyl)amino]butan-2-yl 2-aminoacetate |
| PubChem CID | 155066433 |
| Molecular Formula | C10H20N2O4S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 4-[methyl-(2-methylsulfanyloxy-2-oxoethyl)amino]butan-2-yl 2-aminoacetate |
| SMILES | CSOC(=O)CN(C)CCC(C)OC(=O)CN |
| InChI | InChI=1S/C10H20N2O4S/c1-8(15-9(13)6-11)4-5-12(2)7-10(14)16-17-3/h8H,4-7,11H2,1-3H3 |
| InChIKey | SIMNKJMJROWEKW-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[methyl-(2-methylsulfanyloxy-2-oxoethyl)amino]butan-2-yl 2-aminoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[methyl-(2-methylsulfanyloxy-2-oxoethyl)amino]butan-2-yl 2-aminoacetate?
The IUPAC name of 4-[methyl-(2-methylsulfanyloxy-2-oxoethyl)amino]butan-2-yl 2-aminoacetate (CID 155066433) is 4-[methyl-(2-methylsulfanyloxy-2-oxoethyl)amino]butan-2-yl 2-aminoacetate.
What is the SMILES notation for 4-[methyl-(2-methylsulfanyloxy-2-oxoethyl)amino]butan-2-yl 2-aminoacetate?
The canonical SMILES for 4-[methyl-(2-methylsulfanyloxy-2-oxoethyl)amino]butan-2-yl 2-aminoacetate is CSOC(=O)CN(C)CCC(C)OC(=O)CN.
What is the InChIKey of 4-[methyl-(2-methylsulfanyloxy-2-oxoethyl)amino]butan-2-yl 2-aminoacetate?
The InChIKey is SIMNKJMJROWEKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O4S/c1-8(15-9(13)6-11)4-5-12(2)7-10(14)16-17-3/h8H,4-7,11H2,1-3H3.
What are the key properties of 4-[methyl-(2-methylsulfanyloxy-2-oxoethyl)amino]butan-2-yl 2-aminoacetate?
4-[methyl-(2-methylsulfanyloxy-2-oxoethyl)amino]butan-2-yl 2-aminoacetate has a molecular weight of 264.35 g/mol, XLogP of 0.02, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[methyl-(2-methylsulfanyloxy-2-oxoethyl)amino]butan-2-yl 2-aminoacetate is sourced from PubChem (CID 155066433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).