C33H42F3N4O5P — CID 155066471
4-[2-(3-dimethoxyphosphanylpropoxy)phenyl]-1-[2-propyl-1-[4-(trifluoromethyl)pyridine-3-carbonyl]piperidine-3-carbonyl]piperidine-4-carbonitrile (PubChem CID 155066471) has the molecular formula C33H42F3N4O5P and a molecular weight of 662.69 g/mol. Its IUPAC name is 4-[2-(3-dimethoxyphosphanylpropoxy)phenyl]-1-[2-propyl-1-[4-(trifluoromethyl)pyridine-3-carbonyl]piperidine-3-carbonyl]piperidine-4-carbonitrile.
| Compound Name | 4-[2-(3-dimethoxyphosphanylpropoxy)phenyl]-1-[2-propyl-1-[4-(trifluoromethyl)pyridine-3-carbonyl]piperidine-3-carbonyl]piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 155066471 |
| Molecular Formula | C33H42F3N4O5P |
| Molecular Weight | 662.69 g/mol |
| Exact Mass | 662.28 |
| IUPAC Name | 4-[2-(3-dimethoxyphosphanylpropoxy)phenyl]-1-[2-propyl-1-[4-(trifluoromethyl)pyridine-3-carbonyl]piperidine-3-carbonyl]piperidine-4-carbonitrile |
| SMILES | CCCC1C(C(=O)N2CCC(C#N)(c3ccccc3OCCCP(OC)OC)CC2)CCCN1C(=O)c1cnccc1C(F)(F)F |
| InChI | InChI=1S/C33H42F3N4O5P/c1-4-9-28-24(10-7-17-40(28)31(42)25-22-38-16-13-26(25)33(34,35)36)30(41)39-18-14-32(23-37,15-19-39)27-11-5-6-12-29(27)45-20-8-21-46(43-2)44-3/h5-6,11-13,16,22,24,28H,4,7-10,14-15,17-21H2,1-3H3 |
| InChIKey | ATWKVTSMYFXHPQ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 104.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.69 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|