C21H25F2N5O3 — CID 155066728
pentyl 4-[3-[1-(difluoromethyl)indazol-6-yl]-1,2,4-oxadiazol-5-yl]piperidine-1-carboxylate (PubChem CID 155066728) has the molecular formula C21H25F2N5O3 and a molecular weight of 433.46 g/mol. Its IUPAC name is pentyl 4-[3-[1-(difluoromethyl)indazol-6-yl]-1,2,4-oxadiazol-5-yl]piperidine-1-carboxylate.
| Compound Name | pentyl 4-[3-[1-(difluoromethyl)indazol-6-yl]-1,2,4-oxadiazol-5-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 155066728 |
| Molecular Formula | C21H25F2N5O3 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | pentyl 4-[3-[1-(difluoromethyl)indazol-6-yl]-1,2,4-oxadiazol-5-yl]piperidine-1-carboxylate |
| SMILES | CCCCCOC(=O)N1CCC(c2nc(-c3ccc4cnn(C(F)F)c4c3)no2)CC1 |
| InChI | InChI=1S/C21H25F2N5O3/c1-2-3-4-11-30-21(29)27-9-7-14(8-10-27)19-25-18(26-31-19)15-5-6-16-13-24-28(20(22)23)17(16)12-15/h5-6,12-14,20H,2-4,7-11H2,1H3 |
| InChIKey | GDQMWNAVSSGWEY-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|