C11H20N2 — CID 155067569
(3aE,9aS)-6-methyl-2,3,5,6,7,8,9,9a-octahydrocycloocta[b]pyrrol-1-amine (PubChem CID 155067569) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is (3aE,9aS)-6-methyl-2,3,5,6,7,8,9,9a-octahydrocycloocta[b]pyrrol-1-amine.
| Compound Name | (3aE,9aS)-6-methyl-2,3,5,6,7,8,9,9a-octahydrocycloocta[b]pyrrol-1-amine |
|---|---|
| PubChem CID | 155067569 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | (3aE,9aS)-6-methyl-2,3,5,6,7,8,9,9a-octahydrocycloocta[b]pyrrol-1-amine |
| SMILES | CC1C/C=C2/CCN(N)[C@H]2CCC1 |
| InChI | InChI=1S/C11H20N2/c1-9-3-2-4-11-10(6-5-9)7-8-13(11)12/h6,9,11H,2-5,7-8,12H2,1H3/b10-6-/t9?,11-/m0/s1 |
| InChIKey | FYIZCNSFBNBSJM-APUBYTFLSA-N |
| XLogP | 2.07 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|