C16H35F3N4 — CID 155067708
2-(aminomethyl)-N'-[2-(aminomethyl)-5,5,5-trifluoro-2-propylpentyl]-2-methylpentane-1,5-diamine (PubChem CID 155067708) has the molecular formula C16H35F3N4 and a molecular weight of 340.48 g/mol. Its IUPAC name is 2-(aminomethyl)-N'-[2-(aminomethyl)-5,5,5-trifluoro-2-propylpentyl]-2-methylpentane-1,5-diamine.
| Compound Name | 2-(aminomethyl)-N'-[2-(aminomethyl)-5,5,5-trifluoro-2-propylpentyl]-2-methylpentane-1,5-diamine |
|---|---|
| PubChem CID | 155067708 |
| Molecular Formula | C16H35F3N4 |
| Molecular Weight | 340.48 g/mol |
| Exact Mass | 340.28 |
| IUPAC Name | 2-(aminomethyl)-N'-[2-(aminomethyl)-5,5,5-trifluoro-2-propylpentyl]-2-methylpentane-1,5-diamine |
| SMILES | CCCC(CN)(CCC(F)(F)F)CNCCCC(C)(CN)CN |
| InChI | InChI=1S/C16H35F3N4/c1-3-5-15(12-22,7-8-16(17,18)19)13-23-9-4-6-14(2,10-20)11-21/h23H,3-13,20-22H2,1-2H3 |
| InChIKey | BCFGIJYBXQZXRM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.48 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|