C17H37F3N4 — CID 155067709
2-(aminomethyl)-N'-[2-(aminomethyl)-2-(2,2,2-trifluoroethyl)pentyl]-2-propylpentane-1,5-diamine (PubChem CID 155067709) has the molecular formula C17H37F3N4 and a molecular weight of 354.51 g/mol. Its IUPAC name is 2-(aminomethyl)-N'-[2-(aminomethyl)-2-(2,2,2-trifluoroethyl)pentyl]-2-propylpentane-1,5-diamine.
| Compound Name | 2-(aminomethyl)-N'-[2-(aminomethyl)-2-(2,2,2-trifluoroethyl)pentyl]-2-propylpentane-1,5-diamine |
|---|---|
| PubChem CID | 155067709 |
| Molecular Formula | C17H37F3N4 |
| Molecular Weight | 354.51 g/mol |
| Exact Mass | 354.30 |
| IUPAC Name | 2-(aminomethyl)-N'-[2-(aminomethyl)-2-(2,2,2-trifluoroethyl)pentyl]-2-propylpentane-1,5-diamine |
| SMILES | CCCC(CN)(CN)CCCNCC(CN)(CCC)CC(F)(F)F |
| InChI | InChI=1S/C17H37F3N4/c1-3-6-15(11-21,12-22)8-5-9-24-14-16(13-23,7-4-2)10-17(18,19)20/h24H,3-14,21-23H2,1-2H3 |
| InChIKey | PJWGVAUGAPEQCK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.51 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|