About (3,3-dibenzyl-6,8-dioxabicyclo[3.2.1]octan-4-yl) prop-2-enoate
(3,3-dibenzyl-6,8-dioxabicyclo[3.2.1]octan-4-yl) prop-2-enoate (PubChem CID 155068990) has the molecular formula C23H24O4
and a molecular weight of 364.44 g/mol. Its IUPAC name is (3,3-dibenzyl-6,8-dioxabicyclo[3.2.1]octan-4-yl) prop-2-enoate.
Molecular Properties
| Compound Name | (3,3-dibenzyl-6,8-dioxabicyclo[3.2.1]octan-4-yl) prop-2-enoate |
| PubChem CID | 155068990 |
| Molecular Formula | C23H24O4 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | (3,3-dibenzyl-6,8-dioxabicyclo[3.2.1]octan-4-yl) prop-2-enoate |
| SMILES | C=CC(=O)OC1C2OCC(CC1(Cc1ccccc1)Cc1ccccc1)O2 |
| InChI | InChI=1S/C23H24O4/c1-2-20(24)27-21-22-25-16-19(26-22)15-23(21,13-17-9-5-3-6-10-17)14-18-11-7-4-8-12-18/h2-12,19,21-22H,1,13-16H2 |
| InChIKey | MSWBZHNWALTBNA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3,3-dibenzyl-6,8-dioxabicyclo[3.2.1]octan-4-yl) prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,3-dibenzyl-6,8-dioxabicyclo[3.2.1]octan-4-yl) prop-2-enoate?
The IUPAC name of (3,3-dibenzyl-6,8-dioxabicyclo[3.2.1]octan-4-yl) prop-2-enoate (CID 155068990) is (3,3-dibenzyl-6,8-dioxabicyclo[3.2.1]octan-4-yl) prop-2-enoate.
What is the SMILES notation for (3,3-dibenzyl-6,8-dioxabicyclo[3.2.1]octan-4-yl) prop-2-enoate?
The canonical SMILES for (3,3-dibenzyl-6,8-dioxabicyclo[3.2.1]octan-4-yl) prop-2-enoate is C=CC(=O)OC1C2OCC(CC1(Cc1ccccc1)Cc1ccccc1)O2.
What is the InChIKey of (3,3-dibenzyl-6,8-dioxabicyclo[3.2.1]octan-4-yl) prop-2-enoate?
The InChIKey is MSWBZHNWALTBNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24O4/c1-2-20(24)27-21-22-25-16-19(26-22)15-23(21,13-17-9-5-3-6-10-17)14-18-11-7-4-8-12-18/h2-12,19,21-22H,1,13-16H2.
What are the key properties of (3,3-dibenzyl-6,8-dioxabicyclo[3.2.1]octan-4-yl) prop-2-enoate?
(3,3-dibenzyl-6,8-dioxabicyclo[3.2.1]octan-4-yl) prop-2-enoate has a molecular weight of 364.44 g/mol, XLogP of 3.70, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-dibenzyl-6,8-dioxabicyclo[3.2.1]octan-4-yl) prop-2-enoate is sourced from PubChem (CID 155068990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).