C29H25ClN6O4 — CID 155069873
N-[(1S)-1-(3-chlorophenyl)-2,2-dihydroxyethyl]-1-[5-methyl-2-(4-phenoxyanilino)pyrimidin-4-yl]imidazole-4-carboxamide (PubChem CID 155069873) has the molecular formula C29H25ClN6O4 and a molecular weight of 557.01 g/mol. Its IUPAC name is N-[(1S)-1-(3-chlorophenyl)-2,2-dihydroxyethyl]-1-[5-methyl-2-(4-phenoxyanilino)pyrimidin-4-yl]imidazole-4-carboxamide.
| Compound Name | N-[(1S)-1-(3-chlorophenyl)-2,2-dihydroxyethyl]-1-[5-methyl-2-(4-phenoxyanilino)pyrimidin-4-yl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 155069873 |
| Molecular Formula | C29H25ClN6O4 |
| Molecular Weight | 557.01 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | N-[(1S)-1-(3-chlorophenyl)-2,2-dihydroxyethyl]-1-[5-methyl-2-(4-phenoxyanilino)pyrimidin-4-yl]imidazole-4-carboxamide |
| SMILES | Cc1cnc(Nc2ccc(Oc3ccccc3)cc2)nc1-n1cnc(C(=O)N[C@@H](c2cccc(Cl)c2)C(O)O)c1 |
| InChI | InChI=1S/C29H25ClN6O4/c1-18-15-31-29(33-21-10-12-23(13-11-21)40-22-8-3-2-4-9-22)35-26(18)36-16-24(32-17-36)27(37)34-25(28(38)39)19-6-5-7-20(30)14-19/h2-17,25,28,38-39H,1H3,(H,34,37)(H,31,33,35)/t25-/m0/s1 |
| InChIKey | ISLZSAIZYPNHCO-VWLOTQADSA-N |
| XLogP | 4.94 |
| TPSA | 134.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.01 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|