C23H21ClFN7O2 — CID 155069904
N-[2-amino-1-(3-chlorophenyl)-1-hydroxyethyl]-1-[2-(4-fluoroanilino)-5-methylpyrimidin-4-yl]imidazole-4-carboxamide (PubChem CID 155069904) has the molecular formula C23H21ClFN7O2 and a molecular weight of 481.92 g/mol. Its IUPAC name is N-[2-amino-1-(3-chlorophenyl)-1-hydroxyethyl]-1-[2-(4-fluoroanilino)-5-methylpyrimidin-4-yl]imidazole-4-carboxamide.
| Compound Name | N-[2-amino-1-(3-chlorophenyl)-1-hydroxyethyl]-1-[2-(4-fluoroanilino)-5-methylpyrimidin-4-yl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 155069904 |
| Molecular Formula | C23H21ClFN7O2 |
| Molecular Weight | 481.92 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | N-[2-amino-1-(3-chlorophenyl)-1-hydroxyethyl]-1-[2-(4-fluoroanilino)-5-methylpyrimidin-4-yl]imidazole-4-carboxamide |
| SMILES | Cc1cnc(Nc2ccc(F)cc2)nc1-n1cnc(C(=O)NC(O)(CN)c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C23H21ClFN7O2/c1-14-10-27-22(29-18-7-5-17(25)6-8-18)30-20(14)32-11-19(28-13-32)21(33)31-23(34,12-26)15-3-2-4-16(24)9-15/h2-11,13,34H,12,26H2,1H3,(H,31,33)(H,27,29,30) |
| InChIKey | OLSNLEKFWRRNLE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 130.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.92 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|