About N-butyl-N-[3-(trimethyl-λ4-sulfanyl)propyl]prop-2-enamide
N-butyl-N-[3-(trimethyl-λ4-sulfanyl)propyl]prop-2-enamide (PubChem CID 155069923) has the molecular formula C13H27NOS
and a molecular weight of 245.43 g/mol. Its IUPAC name is N-butyl-N-[3-(trimethyl-λ4-sulfanyl)propyl]prop-2-enamide.
Molecular Properties
| Compound Name | N-butyl-N-[3-(trimethyl-λ4-sulfanyl)propyl]prop-2-enamide |
| PubChem CID | 155069923 |
| Molecular Formula | C13H27NOS |
| Molecular Weight | 245.43 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | N-butyl-N-[3-(trimethyl-λ4-sulfanyl)propyl]prop-2-enamide |
| SMILES | C=CC(=O)N(CCCC)CCCS(C)(C)C |
| InChI | InChI=1S/C13H27NOS/c1-6-8-10-14(13(15)7-2)11-9-12-16(3,4)5/h7H,2,6,8-12H2,1,3-5H3 |
| InChIKey | LWBHAVYYUWBZAW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-N-[3-(trimethyl-λ4-sulfanyl)propyl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N-[3-(trimethyl-λ4-sulfanyl)propyl]prop-2-enamide?
The IUPAC name of N-butyl-N-[3-(trimethyl-λ4-sulfanyl)propyl]prop-2-enamide (CID 155069923) is N-butyl-N-[3-(trimethyl-λ4-sulfanyl)propyl]prop-2-enamide.
What is the SMILES notation for N-butyl-N-[3-(trimethyl-λ4-sulfanyl)propyl]prop-2-enamide?
The canonical SMILES for N-butyl-N-[3-(trimethyl-λ4-sulfanyl)propyl]prop-2-enamide is C=CC(=O)N(CCCC)CCCS(C)(C)C.
What is the InChIKey of N-butyl-N-[3-(trimethyl-λ4-sulfanyl)propyl]prop-2-enamide?
The InChIKey is LWBHAVYYUWBZAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NOS/c1-6-8-10-14(13(15)7-2)11-9-12-16(3,4)5/h7H,2,6,8-12H2,1,3-5H3.
What are the key properties of N-butyl-N-[3-(trimethyl-λ4-sulfanyl)propyl]prop-2-enamide?
N-butyl-N-[3-(trimethyl-λ4-sulfanyl)propyl]prop-2-enamide has a molecular weight of 245.43 g/mol, XLogP of 2.89, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N-[3-(trimethyl-λ4-sulfanyl)propyl]prop-2-enamide is sourced from PubChem (CID 155069923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).