C24H36N4 — CID 155070612
(3Z)-5-[(7Z)-2,12-dimethyl-4-[2-(methylamino)ethyl]-3,5-diazabicyclo[7.5.0]tetradeca-1(14),4,7,9,13-pentaen-11-yl]-N-methylhexa-3,5-dien-1-amine (PubChem CID 155070612) has the molecular formula C24H36N4 and a molecular weight of 380.58 g/mol. Its IUPAC name is (3Z)-5-[(7Z)-2,12-dimethyl-4-[2-(methylamino)ethyl]-3,5-diazabicyclo[7.5.0]tetradeca-1(14),4,7,9,13-pentaen-11-yl]-N-methylhexa-3,5-dien-1-amine.
| Compound Name | (3Z)-5-[(7Z)-2,12-dimethyl-4-[2-(methylamino)ethyl]-3,5-diazabicyclo[7.5.0]tetradeca-1(14),4,7,9,13-pentaen-11-yl]-N-methylhexa-3,5-dien-1-amine |
|---|---|
| PubChem CID | 155070612 |
| Molecular Formula | C24H36N4 |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | (3Z)-5-[(7Z)-2,12-dimethyl-4-[2-(methylamino)ethyl]-3,5-diazabicyclo[7.5.0]tetradeca-1(14),4,7,9,13-pentaen-11-yl]-N-methylhexa-3,5-dien-1-amine |
| SMILES | C=C(/C=C\CCNC)C1C=C2/C=C\C/N=C(/CCNC)NC(C)C2=C=CC1C |
| InChI | InChI=1S/C24H36N4/c1-18(9-6-7-14-25-4)23-17-21-10-8-15-27-24(13-16-26-5)28-20(3)22(21)12-11-19(23)2/h6,8-11,17,19-20,23,25-26H,1,7,13-16H2,2-5H3,(H,27,28)/b9-6-,10-8- |
| InChIKey | GYVLRIXOLGRBKG-PTKGMRGESA-N |
| XLogP | 3.54 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|