C29H23N5S — CID 155070766
15-[6-(2-methyl-1H-imidazol-5-yl)-1-benzothiophen-2-yl]-4-propan-2-yl-3,5,11-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,10,14,16-octaene (PubChem CID 155070766) has the molecular formula C29H23N5S and a molecular weight of 473.61 g/mol. Its IUPAC name is 15-[6-(2-methyl-1H-imidazol-5-yl)-1-benzothiophen-2-yl]-4-propan-2-yl-3,5,11-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,10,14,16-octaene.
| Compound Name | 15-[6-(2-methyl-1H-imidazol-5-yl)-1-benzothiophen-2-yl]-4-propan-2-yl-3,5,11-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,10,14,16-octaene |
|---|---|
| PubChem CID | 155070766 |
| Molecular Formula | C29H23N5S |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 15-[6-(2-methyl-1H-imidazol-5-yl)-1-benzothiophen-2-yl]-4-propan-2-yl-3,5,11-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,10,14,16-octaene |
| SMILES | Cc1ncc(-c2ccc3cc(-c4ccc5c(c4)c4ncccc4c4nc(C(C)C)[nH]c54)sc3c2)[nH]1 |
| InChI | InChI=1S/C29H23N5S/c1-15(2)29-33-27-20-9-8-18(11-22(20)26-21(28(27)34-29)5-4-10-30-26)25-13-19-7-6-17(12-24(19)35-25)23-14-31-16(3)32-23/h4-15H,1-3H3,(H,31,32)(H,33,34) |
| InChIKey | ONBRIZLNDVOMHA-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|