About (4R)-3,4-dimethyl-5-methylidene-1,3-thiazolidine
(4R)-3,4-dimethyl-5-methylidene-1,3-thiazolidine (PubChem CID 155070776) has the molecular formula C6H11NS
and a molecular weight of 129.23 g/mol. Its IUPAC name is (4R)-3,4-dimethyl-5-methylidene-1,3-thiazolidine.
Molecular Properties
| Compound Name | (4R)-3,4-dimethyl-5-methylidene-1,3-thiazolidine |
| PubChem CID | 155070776 |
| Molecular Formula | C6H11NS |
| Molecular Weight | 129.23 g/mol |
| Exact Mass | 129.06 |
| IUPAC Name | (4R)-3,4-dimethyl-5-methylidene-1,3-thiazolidine |
| SMILES | C=C1SCN(C)[C@@H]1C |
| InChI | InChI=1S/C6H11NS/c1-5-6(2)8-4-7(5)3/h5H,2,4H2,1,3H3/t5-/m1/s1 |
| InChIKey | KNUQOYOVGLFGKU-RXMQYKEDSA-N |
| XLogP | 1.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.23 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-3,4-dimethyl-5-methylidene-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-3,4-dimethyl-5-methylidene-1,3-thiazolidine?
The IUPAC name of (4R)-3,4-dimethyl-5-methylidene-1,3-thiazolidine (CID 155070776) is (4R)-3,4-dimethyl-5-methylidene-1,3-thiazolidine.
What is the SMILES notation for (4R)-3,4-dimethyl-5-methylidene-1,3-thiazolidine?
The canonical SMILES for (4R)-3,4-dimethyl-5-methylidene-1,3-thiazolidine is C=C1SCN(C)[C@@H]1C.
What is the InChIKey of (4R)-3,4-dimethyl-5-methylidene-1,3-thiazolidine?
The InChIKey is KNUQOYOVGLFGKU-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H11NS/c1-5-6(2)8-4-7(5)3/h5H,2,4H2,1,3H3/t5-/m1/s1.
What are the key properties of (4R)-3,4-dimethyl-5-methylidene-1,3-thiazolidine?
(4R)-3,4-dimethyl-5-methylidene-1,3-thiazolidine has a molecular weight of 129.23 g/mol, XLogP of 1.52, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-3,4-dimethyl-5-methylidene-1,3-thiazolidine is sourced from PubChem (CID 155070776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).